C22H23NO5 — CID 10809862
4-[1-benzyl-3-(carboxymethyl)-2-methylindol-5-yl]oxybutanoic acid (PubChem CID 10809862) has the molecular formula C22H23NO5 and a molecular weight of 381.43 g/mol. Its IUPAC name is 4-[1-benzyl-3-(carboxymethyl)-2-methylindol-5-yl]oxybutanoic acid.
| Compound Name | 4-[1-benzyl-3-(carboxymethyl)-2-methylindol-5-yl]oxybutanoic acid |
|---|---|
| PubChem CID | 10809862 |
| Molecular Formula | C22H23NO5 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 4-[1-benzyl-3-(carboxymethyl)-2-methylindol-5-yl]oxybutanoic acid |
| SMILES | Cc1c(CC(=O)O)c2cc(OCCCC(=O)O)ccc2n1Cc1ccccc1 |
| InChI | InChI=1S/C22H23NO5/c1-15-18(13-22(26)27)19-12-17(28-11-5-8-21(24)25)9-10-20(19)23(15)14-16-6-3-2-4-7-16/h2-4,6-7,9-10,12H,5,8,11,13-14H2,1H3,(H,24,25)(H,26,27) |
| InChIKey | OPTKWFXPTZYQAD-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|