C16H22N3S+ — CID 10810011
3-(3-methyl-8-aza-5-azoniaspiro[4.5]decan-8-yl)-1,2-benzothiazole (PubChem CID 10810011) has the molecular formula C16H22N3S+ and a molecular weight of 288.44 g/mol. Its IUPAC name is 3-(3-methyl-8-aza-5-azoniaspiro[4.5]decan-8-yl)-1,2-benzothiazole.
| Compound Name | 3-(3-methyl-8-aza-5-azoniaspiro[4.5]decan-8-yl)-1,2-benzothiazole |
|---|---|
| PubChem CID | 10810011 |
| Molecular Formula | C16H22N3S+ |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 3-(3-methyl-8-aza-5-azoniaspiro[4.5]decan-8-yl)-1,2-benzothiazole |
| SMILES | CC1CC[N+]2(CCN(c3nsc4ccccc34)CC2)C1 |
| InChI | InChI=1S/C16H22N3S/c1-13-6-9-19(12-13)10-7-18(8-11-19)16-14-4-2-3-5-15(14)20-17-16/h2-5,13H,6-12H2,1H3/q+1 |
| InChIKey | NCJPSROKBBHUCF-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|