C24H32O4 — CID 10810084
(1R,4S,5R,8S,9R,10R,12R,13R)-10-[(3-ethenylphenyl)methyl]-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane (PubChem CID 10810084) has the molecular formula C24H32O4 and a molecular weight of 384.52 g/mol. Its IUPAC name is (1R,4S,5R,8S,9R,10R,12R,13R)-10-[(3-ethenylphenyl)methyl]-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane.
| Compound Name | (1R,4S,5R,8S,9R,10R,12R,13R)-10-[(3-ethenylphenyl)methyl]-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane |
|---|---|
| PubChem CID | 10810084 |
| Molecular Formula | C24H32O4 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | (1R,4S,5R,8S,9R,10R,12R,13R)-10-[(3-ethenylphenyl)methyl]-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane |
| SMILES | C=Cc1cccc(C[C@H]2O[C@@H]3O[C@@]4(C)CC[C@H]5[C@H](C)CC[C@@H]([C@H]2C)[C@@]35OO4)c1 |
| InChI | InChI=1S/C24H32O4/c1-5-17-7-6-8-18(13-17)14-21-16(3)20-10-9-15(2)19-11-12-23(4)26-22(25-21)24(19,20)28-27-23/h5-8,13,15-16,19-22H,1,9-12,14H2,2-4H3/t15-,16-,19+,20+,21-,22-,23-,24-/m1/s1 |
| InChIKey | HBRORWIKPBZTSE-SBTIGIGZSA-N |
| XLogP | 5.12 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|