C13H16N6O3S — CID 1081022
1-[4-(furan-2-carbonyl)piperazin-1-yl]-2-(1-methyltetrazol-5-yl)sulfanylethanone (PubChem CID 1081022) has the molecular formula C13H16N6O3S and a molecular weight of 336.38 g/mol. Its IUPAC name is 1-[4-(furan-2-carbonyl)piperazin-1-yl]-2-(1-methyltetrazol-5-yl)sulfanylethanone.
| Compound Name | 1-[4-(furan-2-carbonyl)piperazin-1-yl]-2-(1-methyltetrazol-5-yl)sulfanylethanone |
|---|---|
| PubChem CID | 1081022 |
| Molecular Formula | C13H16N6O3S |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | 1-[4-(furan-2-carbonyl)piperazin-1-yl]-2-(1-methyltetrazol-5-yl)sulfanylethanone |
| SMILES | Cn1nnnc1SCC(=O)N1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C13H16N6O3S/c1-17-13(14-15-16-17)23-9-11(20)18-4-6-19(7-5-18)12(21)10-3-2-8-22-10/h2-3,8H,4-7,9H2,1H3 |
| InChIKey | CIEDXXKJAJAOGW-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |