C18H17N3O3S2 — CID 10810266
(5Z)-5-[[4-[[(2S)-1-(1,3-thiazol-2-yl)pyrrolidin-2-yl]methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 10810266) has the molecular formula C18H17N3O3S2 and a molecular weight of 387.49 g/mol. Its IUPAC name is (5Z)-5-[[4-[[(2S)-1-(1,3-thiazol-2-yl)pyrrolidin-2-yl]methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[4-[[(2S)-1-(1,3-thiazol-2-yl)pyrrolidin-2-yl]methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 10810266 |
| Molecular Formula | C18H17N3O3S2 |
| Molecular Weight | 387.49 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | (5Z)-5-[[4-[[(2S)-1-(1,3-thiazol-2-yl)pyrrolidin-2-yl]methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C/c2ccc(OC[C@@H]3CCCN3c3nccs3)cc2)S1 |
| InChI | InChI=1S/C18H17N3O3S2/c22-16-15(26-18(23)20-16)10-12-3-5-14(6-4-12)24-11-13-2-1-8-21(13)17-19-7-9-25-17/h3-7,9-10,13H,1-2,8,11H2,(H,20,22,23)/b15-10-/t13-/m0/s1 |
| InChIKey | KJTXRQPOEMWOPK-OJNRTJSBSA-N |
| XLogP | 3.51 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.49 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|