C24H25NO4 — CID 10810475
diethyl 2-methyl-4,6-diphenyl-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 10810475) has the molecular formula C24H25NO4 and a molecular weight of 391.47 g/mol. Its IUPAC name is diethyl 2-methyl-4,6-diphenyl-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | diethyl 2-methyl-4,6-diphenyl-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 10810475 |
| Molecular Formula | C24H25NO4 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | diethyl 2-methyl-4,6-diphenyl-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C)NC(c2ccccc2)=C(C(=O)OCC)C1c1ccccc1 |
| InChI | InChI=1S/C24H25NO4/c1-4-28-23(26)19-16(3)25-22(18-14-10-7-11-15-18)21(24(27)29-5-2)20(19)17-12-8-6-9-13-17/h6-15,20,25H,4-5H2,1-3H3 |
| InChIKey | SZXGFKTVFOFVLP-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |