C19H23NO4S2 — CID 10810595
N-[[(2R,3R)-3-butyloxiran-2-yl]-oxo-phenyl-λ6-sulfanylidene]-4-methylbenzenesulfonamide (PubChem CID 10810595) has the molecular formula C19H23NO4S2 and a molecular weight of 393.53 g/mol. Its IUPAC name is N-[[(2R,3R)-3-butyloxiran-2-yl]-oxo-phenyl-λ6-sulfanylidene]-4-methylbenzenesulfonamide.
| Compound Name | N-[[(2R,3R)-3-butyloxiran-2-yl]-oxo-phenyl-λ6-sulfanylidene]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 10810595 |
| Molecular Formula | C19H23NO4S2 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | N-[[(2R,3R)-3-butyloxiran-2-yl]-oxo-phenyl-λ6-sulfanylidene]-4-methylbenzenesulfonamide |
| SMILES | CCCC[C@H]1O[C@@H]1S(=O)(=NS(=O)(=O)c1ccc(C)cc1)c1ccccc1 |
| InChI | InChI=1S/C19H23NO4S2/c1-3-4-10-18-19(24-18)25(21,16-8-6-5-7-9-16)20-26(22,23)17-13-11-15(2)12-14-17/h5-9,11-14,18-19H,3-4,10H2,1-2H3/t18-,19-,25?/m1/s1 |
| InChIKey | ODKKRBOZFMGAHS-CKPMZPGQSA-N |
| XLogP | 4.13 |
| TPSA | 76.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|