C17H20INO2 — CID 10810791
[(1R,2R,3S,5S)-2-ethenyl-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 4-iodobenzoate (PubChem CID 10810791) has the molecular formula C17H20INO2 and a molecular weight of 397.26 g/mol. Its IUPAC name is [(1R,2R,3S,5S)-2-ethenyl-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 4-iodobenzoate.
| Compound Name | [(1R,2R,3S,5S)-2-ethenyl-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 4-iodobenzoate |
|---|---|
| PubChem CID | 10810791 |
| Molecular Formula | C17H20INO2 |
| Molecular Weight | 397.26 g/mol |
| Exact Mass | 397.05 |
| IUPAC Name | [(1R,2R,3S,5S)-2-ethenyl-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 4-iodobenzoate |
| SMILES | C=C[C@H]1[C@@H](OC(=O)c2ccc(I)cc2)C[C@@H]2CC[C@H]1N2C |
| InChI | InChI=1S/C17H20INO2/c1-3-14-15-9-8-13(19(15)2)10-16(14)21-17(20)11-4-6-12(18)7-5-11/h3-7,13-16H,1,8-10H2,2H3/t13-,14+,15+,16-/m0/s1 |
| InChIKey | CQFFQKYBSCXZRX-JJXSEGSLSA-N |
| XLogP | 3.49 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.26 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|