About 2,4,4-trimethylpentyl 4-(2-hydroxy-3-phenylphenyl)benzoate
2,4,4-trimethylpentyl 4-(2-hydroxy-3-phenylphenyl)benzoate (PubChem CID 10811119) has the molecular formula C27H30O3
and a molecular weight of 402.53 g/mol. Its IUPAC name is 2,4,4-trimethylpentyl 4-(2-hydroxy-3-phenylphenyl)benzoate.
Molecular Properties
| Compound Name | 2,4,4-trimethylpentyl 4-(2-hydroxy-3-phenylphenyl)benzoate |
| PubChem CID | 10811119 |
| Molecular Formula | C27H30O3 |
| Molecular Weight | 402.53 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | 2,4,4-trimethylpentyl 4-(2-hydroxy-3-phenylphenyl)benzoate |
| SMILES | CC(COC(=O)c1ccc(-c2cccc(-c3ccccc3)c2O)cc1)CC(C)(C)C |
| InChI | InChI=1S/C27H30O3/c1-19(17-27(2,3)4)18-30-26(29)22-15-13-21(14-16-22)24-12-8-11-23(25(24)28)20-9-6-5-7-10-20/h5-16,19,28H,17-18H2,1-4H3 |
| InChIKey | MUZIAEWWAUGIJK-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 402.53 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,4,4-trimethylpentyl 4-(2-hydroxy-3-phenylphenyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4,4-trimethylpentyl 4-(2-hydroxy-3-phenylphenyl)benzoate?
The IUPAC name of 2,4,4-trimethylpentyl 4-(2-hydroxy-3-phenylphenyl)benzoate (CID 10811119) is 2,4,4-trimethylpentyl 4-(2-hydroxy-3-phenylphenyl)benzoate.
What is the SMILES notation for 2,4,4-trimethylpentyl 4-(2-hydroxy-3-phenylphenyl)benzoate?
The canonical SMILES for 2,4,4-trimethylpentyl 4-(2-hydroxy-3-phenylphenyl)benzoate is CC(COC(=O)c1ccc(-c2cccc(-c3ccccc3)c2O)cc1)CC(C)(C)C.
What is the InChIKey of 2,4,4-trimethylpentyl 4-(2-hydroxy-3-phenylphenyl)benzoate?
The InChIKey is MUZIAEWWAUGIJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H30O3/c1-19(17-27(2,3)4)18-30-26(29)22-15-13-21(14-16-22)24-12-8-11-23(25(24)28)20-9-6-5-7-10-20/h5-16,19,28H,17-18H2,1-4H3.
What are the key properties of 2,4,4-trimethylpentyl 4-(2-hydroxy-3-phenylphenyl)benzoate?
2,4,4-trimethylpentyl 4-(2-hydroxy-3-phenylphenyl)benzoate has a molecular weight of 402.53 g/mol, XLogP of 6.96, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4,4-trimethylpentyl 4-(2-hydroxy-3-phenylphenyl)benzoate is sourced from PubChem (CID 10811119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).