C12H7F11N2O — CID 10811184
(1E)-2,2,3,3,4,4,5,5,6,6,6-undecafluoro-N-(3-methylpyridin-1-ium-1-yl)hexanimidate (PubChem CID 10811184) has the molecular formula C12H7F11N2O and a molecular weight of 404.18 g/mol. Its IUPAC name is (1E)-2,2,3,3,4,4,5,5,6,6,6-undecafluoro-N-(3-methylpyridin-1-ium-1-yl)hexanimidate.
| Compound Name | (1E)-2,2,3,3,4,4,5,5,6,6,6-undecafluoro-N-(3-methylpyridin-1-ium-1-yl)hexanimidate |
|---|---|
| PubChem CID | 10811184 |
| Molecular Formula | C12H7F11N2O |
| Molecular Weight | 404.18 g/mol |
| Exact Mass | 404.04 |
| IUPAC Name | (1E)-2,2,3,3,4,4,5,5,6,6,6-undecafluoro-N-(3-methylpyridin-1-ium-1-yl)hexanimidate |
| SMILES | Cc1ccc[n+](/N=C(/[O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C12H7F11N2O/c1-6-3-2-4-25(5-6)24-7(26)8(13,14)9(15,16)10(17,18)11(19,20)12(21,22)23/h2-5H,1H3 |
| InChIKey | AAWSAAQZLZEHOF-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 39.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.18 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|