About [2-chloro-4-[(5-fluoro-1,3-benzothiazol-2-yl)methoxy]phenyl]-cyclohexylmethanol
[2-chloro-4-[(5-fluoro-1,3-benzothiazol-2-yl)methoxy]phenyl]-cyclohexylmethanol (PubChem CID 10811291) has the molecular formula C21H21ClFNO2S
and a molecular weight of 405.92 g/mol. Its IUPAC name is [2-chloro-4-[(5-fluoro-1,3-benzothiazol-2-yl)methoxy]phenyl]-cyclohexylmethanol.
Molecular Properties
| Compound Name | [2-chloro-4-[(5-fluoro-1,3-benzothiazol-2-yl)methoxy]phenyl]-cyclohexylmethanol |
| PubChem CID | 10811291 |
| Molecular Formula | C21H21ClFNO2S |
| Molecular Weight | 405.92 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | [2-chloro-4-[(5-fluoro-1,3-benzothiazol-2-yl)methoxy]phenyl]-cyclohexylmethanol |
| SMILES | OC(c1ccc(OCc2nc3cc(F)ccc3s2)cc1Cl)C1CCCCC1 |
| InChI | InChI=1S/C21H21ClFNO2S/c22-17-11-15(7-8-16(17)21(25)13-4-2-1-3-5-13)26-12-20-24-18-10-14(23)6-9-19(18)27-20/h6-11,13,21,25H,1-5,12H2 |
| InChIKey | FTXZUKCRNQLBGS-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 405.92 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-chloro-4-[(5-fluoro-1,3-benzothiazol-2-yl)methoxy]phenyl]-cyclohexylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-chloro-4-[(5-fluoro-1,3-benzothiazol-2-yl)methoxy]phenyl]-cyclohexylmethanol?
The IUPAC name of [2-chloro-4-[(5-fluoro-1,3-benzothiazol-2-yl)methoxy]phenyl]-cyclohexylmethanol (CID 10811291) is [2-chloro-4-[(5-fluoro-1,3-benzothiazol-2-yl)methoxy]phenyl]-cyclohexylmethanol.
What is the SMILES notation for [2-chloro-4-[(5-fluoro-1,3-benzothiazol-2-yl)methoxy]phenyl]-cyclohexylmethanol?
The canonical SMILES for [2-chloro-4-[(5-fluoro-1,3-benzothiazol-2-yl)methoxy]phenyl]-cyclohexylmethanol is OC(c1ccc(OCc2nc3cc(F)ccc3s2)cc1Cl)C1CCCCC1.
What is the InChIKey of [2-chloro-4-[(5-fluoro-1,3-benzothiazol-2-yl)methoxy]phenyl]-cyclohexylmethanol?
The InChIKey is FTXZUKCRNQLBGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21ClFNO2S/c22-17-11-15(7-8-16(17)21(25)13-4-2-1-3-5-13)26-12-20-24-18-10-14(23)6-9-19(18)27-20/h6-11,13,21,25H,1-5,12H2.
What are the key properties of [2-chloro-4-[(5-fluoro-1,3-benzothiazol-2-yl)methoxy]phenyl]-cyclohexylmethanol?
[2-chloro-4-[(5-fluoro-1,3-benzothiazol-2-yl)methoxy]phenyl]-cyclohexylmethanol has a molecular weight of 405.92 g/mol, XLogP of 6.28, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-chloro-4-[(5-fluoro-1,3-benzothiazol-2-yl)methoxy]phenyl]-cyclohexylmethanol is sourced from PubChem (CID 10811291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).