C24H26N2O4 — CID 10811319
2-[2-[1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)piperidin-4-yl]ethyl]isoindole-1,3-dione (PubChem CID 10811319) has the molecular formula C24H26N2O4 and a molecular weight of 406.48 g/mol. Its IUPAC name is 2-[2-[1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)piperidin-4-yl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)piperidin-4-yl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 10811319 |
| Molecular Formula | C24H26N2O4 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | 2-[2-[1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)piperidin-4-yl]ethyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCC1CCN(CC2COc3ccccc3O2)CC1 |
| InChI | InChI=1S/C24H26N2O4/c27-23-19-5-1-2-6-20(19)24(28)26(23)14-11-17-9-12-25(13-10-17)15-18-16-29-21-7-3-4-8-22(21)30-18/h1-8,17-18H,9-16H2 |
| InChIKey | VODCXRCWROSAKX-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|