C25H33N3O2 — CID 10811378
7-[4-[4-(2,3-dimethylphenyl)piperazin-1-yl]butoxy]-3,4-dihydro-1H-quinolin-2-one (PubChem CID 10811378) has the molecular formula C25H33N3O2 and a molecular weight of 407.56 g/mol. Its IUPAC name is 7-[4-[4-(2,3-dimethylphenyl)piperazin-1-yl]butoxy]-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 7-[4-[4-(2,3-dimethylphenyl)piperazin-1-yl]butoxy]-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 10811378 |
| Molecular Formula | C25H33N3O2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.26 |
| IUPAC Name | 7-[4-[4-(2,3-dimethylphenyl)piperazin-1-yl]butoxy]-3,4-dihydro-1H-quinolin-2-one |
| SMILES | Cc1cccc(N2CCN(CCCCOc3ccc4c(c3)NC(=O)CC4)CC2)c1C |
| InChI | InChI=1S/C25H33N3O2/c1-19-6-5-7-24(20(19)2)28-15-13-27(14-16-28)12-3-4-17-30-22-10-8-21-9-11-25(29)26-23(21)18-22/h5-8,10,18H,3-4,9,11-17H2,1-2H3,(H,26,29) |
| InChIKey | ROIODKFPKIFWND-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|