C25H20N4O2 — CID 10811419
3,23-dimethyl-13-(propan-2-ylideneamino)-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaene-12,14-dione (PubChem CID 10811419) has the molecular formula C25H20N4O2 and a molecular weight of 408.46 g/mol. Its IUPAC name is 3,23-dimethyl-13-(propan-2-ylideneamino)-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaene-12,14-dione.
| Compound Name | 3,23-dimethyl-13-(propan-2-ylideneamino)-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaene-12,14-dione |
|---|---|
| PubChem CID | 10811419 |
| Molecular Formula | C25H20N4O2 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | 3,23-dimethyl-13-(propan-2-ylideneamino)-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaene-12,14-dione |
| SMILES | CC(C)=NN1C(=O)c2c(c3c4ccccc4n(C)c3c3c2c2ccccc2n3C)C1=O |
| InChI | InChI=1S/C25H20N4O2/c1-13(2)26-29-24(30)20-18-14-9-5-7-11-16(14)27(3)22(18)23-19(21(20)25(29)31)15-10-6-8-12-17(15)28(23)4/h5-12H,1-4H3 |
| InChIKey | PGKKCMBSJQBKOU-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 59.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|