C21H28F3NO2Si — CID 10811578
N,N-dibenzyl-3,3,3-trifluoro-2-methoxy-2-trimethylsilyloxypropan-1-amine (PubChem CID 10811578) has the molecular formula C21H28F3NO2Si and a molecular weight of 411.54 g/mol. Its IUPAC name is N,N-dibenzyl-3,3,3-trifluoro-2-methoxy-2-trimethylsilyloxypropan-1-amine.
| Compound Name | N,N-dibenzyl-3,3,3-trifluoro-2-methoxy-2-trimethylsilyloxypropan-1-amine |
|---|---|
| PubChem CID | 10811578 |
| Molecular Formula | C21H28F3NO2Si |
| Molecular Weight | 411.54 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | N,N-dibenzyl-3,3,3-trifluoro-2-methoxy-2-trimethylsilyloxypropan-1-amine |
| SMILES | COC(CN(Cc1ccccc1)Cc1ccccc1)(O[Si](C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C21H28F3NO2Si/c1-26-20(21(22,23)24,27-28(2,3)4)17-25(15-18-11-7-5-8-12-18)16-19-13-9-6-10-14-19/h5-14H,15-17H2,1-4H3 |
| InChIKey | PRYHYNKCNQVOMJ-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.54 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|