C20H18N2O3Se — CID 10811663
5,7-bis(4-methoxyphenyl)-5,7-dihydro-4H-1,2,3-benzoselenadiazol-6-one (PubChem CID 10811663) has the molecular formula C20H18N2O3Se and a molecular weight of 413.34 g/mol. Its IUPAC name is 5,7-bis(4-methoxyphenyl)-5,7-dihydro-4H-1,2,3-benzoselenadiazol-6-one.
| Compound Name | 5,7-bis(4-methoxyphenyl)-5,7-dihydro-4H-1,2,3-benzoselenadiazol-6-one |
|---|---|
| PubChem CID | 10811663 |
| Molecular Formula | C20H18N2O3Se |
| Molecular Weight | 413.34 g/mol |
| Exact Mass | 414.05 |
| IUPAC Name | 5,7-bis(4-methoxyphenyl)-5,7-dihydro-4H-1,2,3-benzoselenadiazol-6-one |
| SMILES | COc1ccc(C2Cc3nn[se]c3C(c3ccc(OC)cc3)C2=O)cc1 |
| InChI | InChI=1S/C20H18N2O3Se/c1-24-14-7-3-12(4-8-14)16-11-17-20(26-22-21-17)18(19(16)23)13-5-9-15(25-2)10-6-13/h3-10,16,18H,11H2,1-2H3 |
| InChIKey | QVHGVCAFNJFRFQ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.34 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|