About 6-(3,4-difluorophenyl)-N,9-bis(oxan-2-yl)purin-2-amine
6-(3,4-difluorophenyl)-N,9-bis(oxan-2-yl)purin-2-amine (PubChem CID 10811780) has the molecular formula C21H23F2N5O2
and a molecular weight of 415.44 g/mol. Its IUPAC name is 6-(3,4-difluorophenyl)-N,9-bis(oxan-2-yl)purin-2-amine.
Molecular Properties
| Compound Name | 6-(3,4-difluorophenyl)-N,9-bis(oxan-2-yl)purin-2-amine |
| PubChem CID | 10811780 |
| Molecular Formula | C21H23F2N5O2 |
| Molecular Weight | 415.44 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | 6-(3,4-difluorophenyl)-N,9-bis(oxan-2-yl)purin-2-amine |
| SMILES | Fc1ccc(-c2nc(NC3CCCCO3)nc3c2ncn3C2CCCCO2)cc1F |
| InChI | InChI=1S/C21H23F2N5O2/c22-14-8-7-13(11-15(14)23)18-19-20(28(12-24-19)17-6-2-4-10-30-17)27-21(26-18)25-16-5-1-3-9-29-16/h7-8,11-12,16-17H,1-6,9-10H2,(H,25,26,27) |
| InChIKey | AAARBTRVRVZHQB-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.44 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 6-(3,4-difluorophenyl)-N,9-bis(oxan-2-yl)purin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3,4-difluorophenyl)-N,9-bis(oxan-2-yl)purin-2-amine?
The IUPAC name of 6-(3,4-difluorophenyl)-N,9-bis(oxan-2-yl)purin-2-amine (CID 10811780) is 6-(3,4-difluorophenyl)-N,9-bis(oxan-2-yl)purin-2-amine.
What is the SMILES notation for 6-(3,4-difluorophenyl)-N,9-bis(oxan-2-yl)purin-2-amine?
The canonical SMILES for 6-(3,4-difluorophenyl)-N,9-bis(oxan-2-yl)purin-2-amine is Fc1ccc(-c2nc(NC3CCCCO3)nc3c2ncn3C2CCCCO2)cc1F.
What is the InChIKey of 6-(3,4-difluorophenyl)-N,9-bis(oxan-2-yl)purin-2-amine?
The InChIKey is AAARBTRVRVZHQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23F2N5O2/c22-14-8-7-13(11-15(14)23)18-19-20(28(12-24-19)17-6-2-4-10-30-17)27-21(26-18)25-16-5-1-3-9-29-16/h7-8,11-12,16-17H,1-6,9-10H2,(H,25,26,27).
What are the key properties of 6-(3,4-difluorophenyl)-N,9-bis(oxan-2-yl)purin-2-amine?
6-(3,4-difluorophenyl)-N,9-bis(oxan-2-yl)purin-2-amine has a molecular weight of 415.44 g/mol, XLogP of 4.41, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3,4-difluorophenyl)-N,9-bis(oxan-2-yl)purin-2-amine is sourced from PubChem (CID 10811780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).