C21H30N4OS2 — CID 10811983
3-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butyl]-2,5,5-trimethyl-1,3-thiazolidin-4-one (PubChem CID 10811983) has the molecular formula C21H30N4OS2 and a molecular weight of 418.63 g/mol. Its IUPAC name is 3-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butyl]-2,5,5-trimethyl-1,3-thiazolidin-4-one.
| Compound Name | 3-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butyl]-2,5,5-trimethyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 10811983 |
| Molecular Formula | C21H30N4OS2 |
| Molecular Weight | 418.63 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | 3-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butyl]-2,5,5-trimethyl-1,3-thiazolidin-4-one |
| SMILES | CC1SC(C)(C)C(=O)N1CCCCN1CCN(c2nsc3ccccc23)CC1 |
| InChI | InChI=1S/C21H30N4OS2/c1-16-25(20(26)21(2,3)27-16)11-7-6-10-23-12-14-24(15-13-23)19-17-8-4-5-9-18(17)28-22-19/h4-5,8-9,16H,6-7,10-15H2,1-3H3 |
| InChIKey | BQJGXJBNCVRJQI-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.63 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|