C22H32N2O6 — CID 10812079
diethyl (2R,4R)-1-benzyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidine-2,4-dicarboxylate (PubChem CID 10812079) has the molecular formula C22H32N2O6 and a molecular weight of 420.51 g/mol. Its IUPAC name is diethyl (2R,4R)-1-benzyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidine-2,4-dicarboxylate.
| Compound Name | diethyl (2R,4R)-1-benzyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidine-2,4-dicarboxylate |
|---|---|
| PubChem CID | 10812079 |
| Molecular Formula | C22H32N2O6 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | diethyl (2R,4R)-1-benzyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidine-2,4-dicarboxylate |
| SMILES | CCOC(=O)[C@H]1C[C@](NC(=O)OC(C)(C)C)(C(=O)OCC)CN1Cc1ccccc1 |
| InChI | InChI=1S/C22H32N2O6/c1-6-28-18(25)17-13-22(19(26)29-7-2,23-20(27)30-21(3,4)5)15-24(17)14-16-11-9-8-10-12-16/h8-12,17H,6-7,13-15H2,1-5H3,(H,23,27)/t17-,22-/m1/s1 |
| InChIKey | ANRZLNGCYSWXND-VGOFRKELSA-N |
| XLogP | 2.65 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|