About 1-[4-(2-methylimidazo[4,5-c]pyridin-1-yl)piperidin-1-yl]-3,3-diphenylpropan-1-one
1-[4-(2-methylimidazo[4,5-c]pyridin-1-yl)piperidin-1-yl]-3,3-diphenylpropan-1-one (PubChem CID 10812266) has the molecular formula C27H28N4O
and a molecular weight of 424.55 g/mol. Its IUPAC name is 1-[4-(2-methylimidazo[4,5-c]pyridin-1-yl)piperidin-1-yl]-3,3-diphenylpropan-1-one.
Molecular Properties
| Compound Name | 1-[4-(2-methylimidazo[4,5-c]pyridin-1-yl)piperidin-1-yl]-3,3-diphenylpropan-1-one |
| PubChem CID | 10812266 |
| Molecular Formula | C27H28N4O |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.23 |
| IUPAC Name | 1-[4-(2-methylimidazo[4,5-c]pyridin-1-yl)piperidin-1-yl]-3,3-diphenylpropan-1-one |
| SMILES | Cc1nc2cnccc2n1C1CCN(C(=O)CC(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C27H28N4O/c1-20-29-25-19-28-15-12-26(25)31(20)23-13-16-30(17-14-23)27(32)18-24(21-8-4-2-5-9-21)22-10-6-3-7-11-22/h2-12,15,19,23-24H,13-14,16-18H2,1H3 |
| InChIKey | DOYLLQXZMXPFEJ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[4-(2-methylimidazo[4,5-c]pyridin-1-yl)piperidin-1-yl]-3,3-diphenylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(2-methylimidazo[4,5-c]pyridin-1-yl)piperidin-1-yl]-3,3-diphenylpropan-1-one?
The IUPAC name of 1-[4-(2-methylimidazo[4,5-c]pyridin-1-yl)piperidin-1-yl]-3,3-diphenylpropan-1-one (CID 10812266) is 1-[4-(2-methylimidazo[4,5-c]pyridin-1-yl)piperidin-1-yl]-3,3-diphenylpropan-1-one.
What is the SMILES notation for 1-[4-(2-methylimidazo[4,5-c]pyridin-1-yl)piperidin-1-yl]-3,3-diphenylpropan-1-one?
The canonical SMILES for 1-[4-(2-methylimidazo[4,5-c]pyridin-1-yl)piperidin-1-yl]-3,3-diphenylpropan-1-one is Cc1nc2cnccc2n1C1CCN(C(=O)CC(c2ccccc2)c2ccccc2)CC1.
What is the InChIKey of 1-[4-(2-methylimidazo[4,5-c]pyridin-1-yl)piperidin-1-yl]-3,3-diphenylpropan-1-one?
The InChIKey is DOYLLQXZMXPFEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H28N4O/c1-20-29-25-19-28-15-12-26(25)31(20)23-13-16-30(17-14-23)27(32)18-24(21-8-4-2-5-9-21)22-10-6-3-7-11-22/h2-12,15,19,23-24H,13-14,16-18H2,1H3.
What are the key properties of 1-[4-(2-methylimidazo[4,5-c]pyridin-1-yl)piperidin-1-yl]-3,3-diphenylpropan-1-one?
1-[4-(2-methylimidazo[4,5-c]pyridin-1-yl)piperidin-1-yl]-3,3-diphenylpropan-1-one has a molecular weight of 424.55 g/mol, XLogP of 5.13, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(2-methylimidazo[4,5-c]pyridin-1-yl)piperidin-1-yl]-3,3-diphenylpropan-1-one is sourced from PubChem (CID 10812266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).