About methyl 1-methoxy-6,6-dimethyl-3-(2-methyloctan-2-yl)benzo[c]chromene-9-carboxylate
methyl 1-methoxy-6,6-dimethyl-3-(2-methyloctan-2-yl)benzo[c]chromene-9-carboxylate (PubChem CID 10812269) has the molecular formula C27H36O4
and a molecular weight of 424.58 g/mol. Its IUPAC name is methyl 1-methoxy-6,6-dimethyl-3-(2-methyloctan-2-yl)benzo[c]chromene-9-carboxylate.
Molecular Properties
| Compound Name | methyl 1-methoxy-6,6-dimethyl-3-(2-methyloctan-2-yl)benzo[c]chromene-9-carboxylate |
| PubChem CID | 10812269 |
| Molecular Formula | C27H36O4 |
| Molecular Weight | 424.58 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | methyl 1-methoxy-6,6-dimethyl-3-(2-methyloctan-2-yl)benzo[c]chromene-9-carboxylate |
| SMILES | CCCCCCC(C)(C)c1cc(OC)c2c(c1)OC(C)(C)c1ccc(C(=O)OC)cc1-2 |
| InChI | InChI=1S/C27H36O4/c1-8-9-10-11-14-26(2,3)19-16-22(29-6)24-20-15-18(25(28)30-7)12-13-21(20)27(4,5)31-23(24)17-19/h12-13,15-17H,8-11,14H2,1-7H3 |
| InChIKey | BGEQLQHMNLYKKS-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 424.58 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 1-methoxy-6,6-dimethyl-3-(2-methyloctan-2-yl)benzo[c]chromene-9-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-methoxy-6,6-dimethyl-3-(2-methyloctan-2-yl)benzo[c]chromene-9-carboxylate?
The IUPAC name of methyl 1-methoxy-6,6-dimethyl-3-(2-methyloctan-2-yl)benzo[c]chromene-9-carboxylate (CID 10812269) is methyl 1-methoxy-6,6-dimethyl-3-(2-methyloctan-2-yl)benzo[c]chromene-9-carboxylate.
What is the SMILES notation for methyl 1-methoxy-6,6-dimethyl-3-(2-methyloctan-2-yl)benzo[c]chromene-9-carboxylate?
The canonical SMILES for methyl 1-methoxy-6,6-dimethyl-3-(2-methyloctan-2-yl)benzo[c]chromene-9-carboxylate is CCCCCCC(C)(C)c1cc(OC)c2c(c1)OC(C)(C)c1ccc(C(=O)OC)cc1-2.
What is the InChIKey of methyl 1-methoxy-6,6-dimethyl-3-(2-methyloctan-2-yl)benzo[c]chromene-9-carboxylate?
The InChIKey is BGEQLQHMNLYKKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H36O4/c1-8-9-10-11-14-26(2,3)19-16-22(29-6)24-20-15-18(25(28)30-7)12-13-21(20)27(4,5)31-23(24)17-19/h12-13,15-17H,8-11,14H2,1-7H3.
What are the key properties of methyl 1-methoxy-6,6-dimethyl-3-(2-methyloctan-2-yl)benzo[c]chromene-9-carboxylate?
methyl 1-methoxy-6,6-dimethyl-3-(2-methyloctan-2-yl)benzo[c]chromene-9-carboxylate has a molecular weight of 424.58 g/mol, XLogP of 7.02, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-methoxy-6,6-dimethyl-3-(2-methyloctan-2-yl)benzo[c]chromene-9-carboxylate is sourced from PubChem (CID 10812269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).