About 4-(benzotriazol-1-yl)-N,N-diethyl-2-(4-methoxyphenyl)-4H-chromen-7-amine
4-(benzotriazol-1-yl)-N,N-diethyl-2-(4-methoxyphenyl)-4H-chromen-7-amine (PubChem CID 10812358) has the molecular formula C26H26N4O2
and a molecular weight of 426.52 g/mol. Its IUPAC name is 4-(benzotriazol-1-yl)-N,N-diethyl-2-(4-methoxyphenyl)-4H-chromen-7-amine.
Molecular Properties
| Compound Name | 4-(benzotriazol-1-yl)-N,N-diethyl-2-(4-methoxyphenyl)-4H-chromen-7-amine |
| PubChem CID | 10812358 |
| Molecular Formula | C26H26N4O2 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | 4-(benzotriazol-1-yl)-N,N-diethyl-2-(4-methoxyphenyl)-4H-chromen-7-amine |
| SMILES | CCN(CC)c1ccc2c(c1)OC(c1ccc(OC)cc1)=CC2n1nnc2ccccc21 |
| InChI | InChI=1S/C26H26N4O2/c1-4-29(5-2)19-12-15-21-24(30-23-9-7-6-8-22(23)27-28-30)17-25(32-26(21)16-19)18-10-13-20(31-3)14-11-18/h6-17,24H,4-5H2,1-3H3 |
| InChIKey | PDPXEKQZTNQXHE-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 52.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(benzotriazol-1-yl)-N,N-diethyl-2-(4-methoxyphenyl)-4H-chromen-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(benzotriazol-1-yl)-N,N-diethyl-2-(4-methoxyphenyl)-4H-chromen-7-amine?
The IUPAC name of 4-(benzotriazol-1-yl)-N,N-diethyl-2-(4-methoxyphenyl)-4H-chromen-7-amine (CID 10812358) is 4-(benzotriazol-1-yl)-N,N-diethyl-2-(4-methoxyphenyl)-4H-chromen-7-amine.
What is the SMILES notation for 4-(benzotriazol-1-yl)-N,N-diethyl-2-(4-methoxyphenyl)-4H-chromen-7-amine?
The canonical SMILES for 4-(benzotriazol-1-yl)-N,N-diethyl-2-(4-methoxyphenyl)-4H-chromen-7-amine is CCN(CC)c1ccc2c(c1)OC(c1ccc(OC)cc1)=CC2n1nnc2ccccc21.
What is the InChIKey of 4-(benzotriazol-1-yl)-N,N-diethyl-2-(4-methoxyphenyl)-4H-chromen-7-amine?
The InChIKey is PDPXEKQZTNQXHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H26N4O2/c1-4-29(5-2)19-12-15-21-24(30-23-9-7-6-8-22(23)27-28-30)17-25(32-26(21)16-19)18-10-13-20(31-3)14-11-18/h6-17,24H,4-5H2,1-3H3.
What are the key properties of 4-(benzotriazol-1-yl)-N,N-diethyl-2-(4-methoxyphenyl)-4H-chromen-7-amine?
4-(benzotriazol-1-yl)-N,N-diethyl-2-(4-methoxyphenyl)-4H-chromen-7-amine has a molecular weight of 426.52 g/mol, XLogP of 5.31, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(benzotriazol-1-yl)-N,N-diethyl-2-(4-methoxyphenyl)-4H-chromen-7-amine is sourced from PubChem (CID 10812358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).