C15H30F6O3Si2 — CID 10812464
(2-ethoxy-1,1,1,6,6,6-hexafluoro-5-methyl-5-trimethylsilyloxyhexan-2-yl)oxy-trimethylsilane (PubChem CID 10812464) has the molecular formula C15H30F6O3Si2 and a molecular weight of 428.56 g/mol. Its IUPAC name is (2-ethoxy-1,1,1,6,6,6-hexafluoro-5-methyl-5-trimethylsilyloxyhexan-2-yl)oxy-trimethylsilane.
| Compound Name | (2-ethoxy-1,1,1,6,6,6-hexafluoro-5-methyl-5-trimethylsilyloxyhexan-2-yl)oxy-trimethylsilane |
|---|---|
| PubChem CID | 10812464 |
| Molecular Formula | C15H30F6O3Si2 |
| Molecular Weight | 428.56 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | (2-ethoxy-1,1,1,6,6,6-hexafluoro-5-methyl-5-trimethylsilyloxyhexan-2-yl)oxy-trimethylsilane |
| SMILES | CCOC(CCC(C)(O[Si](C)(C)C)C(F)(F)F)(O[Si](C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C15H30F6O3Si2/c1-9-22-13(15(19,20)21,24-26(6,7)8)11-10-12(2,14(16,17)18)23-25(3,4)5/h9-11H2,1-8H3 |
| InChIKey | YKYPFXPHFWZWIO-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.56 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|