C23H34N2O4S — CID 10812752
(2R)-1-[(1R,5S,7S)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-3-methyl-2-(phenylmethoxyamino)pentan-1-one (PubChem CID 10812752) has the molecular formula C23H34N2O4S and a molecular weight of 434.60 g/mol. Its IUPAC name is (2R)-1-[(1R,5S,7S)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-3-methyl-2-(phenylmethoxyamino)pentan-1-one.
| Compound Name | (2R)-1-[(1R,5S,7S)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-3-methyl-2-(phenylmethoxyamino)pentan-1-one |
|---|---|
| PubChem CID | 10812752 |
| Molecular Formula | C23H34N2O4S |
| Molecular Weight | 434.60 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | (2R)-1-[(1R,5S,7S)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-3-methyl-2-(phenylmethoxyamino)pentan-1-one |
| SMILES | CCC(C)[C@@H](NOCc1ccccc1)C(=O)N1[C@H]2C[C@@H]3CC[C@@]2(CS1(=O)=O)C3(C)C |
| InChI | InChI=1S/C23H34N2O4S/c1-5-16(2)20(24-29-14-17-9-7-6-8-10-17)21(26)25-19-13-18-11-12-23(19,22(18,3)4)15-30(25,27)28/h6-10,16,18-20,24H,5,11-15H2,1-4H3/t16?,18-,19-,20+,23-/m0/s1 |
| InChIKey | KHTHEMWLJOIPOV-FBGPNGINSA-N |
| XLogP | 3.49 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.60 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|