About 1-(4-bromophenyl)-3-(4-chlorophenyl)pyrazolo[4,5-c]isoquinoline
1-(4-bromophenyl)-3-(4-chlorophenyl)pyrazolo[4,5-c]isoquinoline (PubChem CID 10812758) has the molecular formula C22H13BrClN3
and a molecular weight of 434.72 g/mol. Its IUPAC name is 1-(4-bromophenyl)-3-(4-chlorophenyl)pyrazolo[4,5-c]isoquinoline.
Molecular Properties
| Compound Name | 1-(4-bromophenyl)-3-(4-chlorophenyl)pyrazolo[4,5-c]isoquinoline |
| PubChem CID | 10812758 |
| Molecular Formula | C22H13BrClN3 |
| Molecular Weight | 434.72 g/mol |
| Exact Mass | 433.00 |
| IUPAC Name | 1-(4-bromophenyl)-3-(4-chlorophenyl)pyrazolo[4,5-c]isoquinoline |
| SMILES | Clc1ccc(-c2nn(-c3ccc(Br)cc3)c3c2ncc2ccccc23)cc1 |
| InChI | InChI=1S/C22H13BrClN3/c23-16-7-11-18(12-8-16)27-22-19-4-2-1-3-15(19)13-25-21(22)20(26-27)14-5-9-17(24)10-6-14/h1-13H |
| InChIKey | PSXDRBJAOBIENC-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 434.72 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(4-bromophenyl)-3-(4-chlorophenyl)pyrazolo[4,5-c]isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-bromophenyl)-3-(4-chlorophenyl)pyrazolo[4,5-c]isoquinoline?
The IUPAC name of 1-(4-bromophenyl)-3-(4-chlorophenyl)pyrazolo[4,5-c]isoquinoline (CID 10812758) is 1-(4-bromophenyl)-3-(4-chlorophenyl)pyrazolo[4,5-c]isoquinoline.
What is the SMILES notation for 1-(4-bromophenyl)-3-(4-chlorophenyl)pyrazolo[4,5-c]isoquinoline?
The canonical SMILES for 1-(4-bromophenyl)-3-(4-chlorophenyl)pyrazolo[4,5-c]isoquinoline is Clc1ccc(-c2nn(-c3ccc(Br)cc3)c3c2ncc2ccccc23)cc1.
What is the InChIKey of 1-(4-bromophenyl)-3-(4-chlorophenyl)pyrazolo[4,5-c]isoquinoline?
The InChIKey is PSXDRBJAOBIENC-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H13BrClN3/c23-16-7-11-18(12-8-16)27-22-19-4-2-1-3-15(19)13-25-21(22)20(26-27)14-5-9-17(24)10-6-14/h1-13H.
What are the key properties of 1-(4-bromophenyl)-3-(4-chlorophenyl)pyrazolo[4,5-c]isoquinoline?
1-(4-bromophenyl)-3-(4-chlorophenyl)pyrazolo[4,5-c]isoquinoline has a molecular weight of 434.72 g/mol, XLogP of 6.66, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-bromophenyl)-3-(4-chlorophenyl)pyrazolo[4,5-c]isoquinoline is sourced from PubChem (CID 10812758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).