About methyl 4-[[4-(2,4-diamino-6-ethylpyrimidin-5-yl)-N-methyl-2-nitroanilino]methyl]benzoate
methyl 4-[[4-(2,4-diamino-6-ethylpyrimidin-5-yl)-N-methyl-2-nitroanilino]methyl]benzoate (PubChem CID 10812819) has the molecular formula C22H24N6O4
and a molecular weight of 436.47 g/mol. Its IUPAC name is methyl 4-[[4-(2,4-diamino-6-ethylpyrimidin-5-yl)-N-methyl-2-nitroanilino]methyl]benzoate.
Molecular Properties
| Compound Name | methyl 4-[[4-(2,4-diamino-6-ethylpyrimidin-5-yl)-N-methyl-2-nitroanilino]methyl]benzoate |
| PubChem CID | 10812819 |
| Molecular Formula | C22H24N6O4 |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | methyl 4-[[4-(2,4-diamino-6-ethylpyrimidin-5-yl)-N-methyl-2-nitroanilino]methyl]benzoate |
| SMILES | CCc1nc(N)nc(N)c1-c1ccc(N(C)Cc2ccc(C(=O)OC)cc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H24N6O4/c1-4-16-19(20(23)26-22(24)25-16)15-9-10-17(18(11-15)28(30)31)27(2)12-13-5-7-14(8-6-13)21(29)32-3/h5-11H,4,12H2,1-3H3,(H4,23,24,25,26) |
| InChIKey | CDIGQXMKOFBXNN-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 150.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-[[4-(2,4-diamino-6-ethylpyrimidin-5-yl)-N-methyl-2-nitroanilino]methyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[[4-(2,4-diamino-6-ethylpyrimidin-5-yl)-N-methyl-2-nitroanilino]methyl]benzoate?
The IUPAC name of methyl 4-[[4-(2,4-diamino-6-ethylpyrimidin-5-yl)-N-methyl-2-nitroanilino]methyl]benzoate (CID 10812819) is methyl 4-[[4-(2,4-diamino-6-ethylpyrimidin-5-yl)-N-methyl-2-nitroanilino]methyl]benzoate.
What is the SMILES notation for methyl 4-[[4-(2,4-diamino-6-ethylpyrimidin-5-yl)-N-methyl-2-nitroanilino]methyl]benzoate?
The canonical SMILES for methyl 4-[[4-(2,4-diamino-6-ethylpyrimidin-5-yl)-N-methyl-2-nitroanilino]methyl]benzoate is CCc1nc(N)nc(N)c1-c1ccc(N(C)Cc2ccc(C(=O)OC)cc2)c([N+](=O)[O-])c1.
What is the InChIKey of methyl 4-[[4-(2,4-diamino-6-ethylpyrimidin-5-yl)-N-methyl-2-nitroanilino]methyl]benzoate?
The InChIKey is CDIGQXMKOFBXNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24N6O4/c1-4-16-19(20(23)26-22(24)25-16)15-9-10-17(18(11-15)28(30)31)27(2)12-13-5-7-14(8-6-13)21(29)32-3/h5-11H,4,12H2,1-3H3,(H4,23,24,25,26).
What are the key properties of methyl 4-[[4-(2,4-diamino-6-ethylpyrimidin-5-yl)-N-methyl-2-nitroanilino]methyl]benzoate?
methyl 4-[[4-(2,4-diamino-6-ethylpyrimidin-5-yl)-N-methyl-2-nitroanilino]methyl]benzoate has a molecular weight of 436.47 g/mol, XLogP of 3.20, 7 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[[4-(2,4-diamino-6-ethylpyrimidin-5-yl)-N-methyl-2-nitroanilino]methyl]benzoate is sourced from PubChem (CID 10812819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).