C25H30O7 — CID 10813088
2-(2,4-diethoxyphenyl)-3,5,7-triethoxychromen-4-one (PubChem CID 10813088) has the molecular formula C25H30O7 and a molecular weight of 442.51 g/mol. Its IUPAC name is 2-(2,4-diethoxyphenyl)-3,5,7-triethoxychromen-4-one.
| Compound Name | 2-(2,4-diethoxyphenyl)-3,5,7-triethoxychromen-4-one |
|---|---|
| PubChem CID | 10813088 |
| Molecular Formula | C25H30O7 |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | 2-(2,4-diethoxyphenyl)-3,5,7-triethoxychromen-4-one |
| SMILES | CCOc1ccc(-c2oc3cc(OCC)cc(OCC)c3c(=O)c2OCC)c(OCC)c1 |
| InChI | InChI=1S/C25H30O7/c1-6-27-16-11-12-18(19(13-16)29-8-3)24-25(31-10-5)23(26)22-20(30-9-4)14-17(28-7-2)15-21(22)32-24/h11-15H,6-10H2,1-5H3 |
| InChIKey | JVGSHXMDRPGOQM-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 76.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |