About [5,8-dioxo-4-(trifluoromethylsulfonyloxy)naphthalen-1-yl] trifluoromethanesulfonate
[5,8-dioxo-4-(trifluoromethylsulfonyloxy)naphthalen-1-yl] trifluoromethanesulfonate (PubChem CID 10813578) has the molecular formula C12H4F6O8S2
and a molecular weight of 454.28 g/mol. Its IUPAC name is [5,8-dioxo-4-(trifluoromethylsulfonyloxy)naphthalen-1-yl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [5,8-dioxo-4-(trifluoromethylsulfonyloxy)naphthalen-1-yl] trifluoromethanesulfonate |
| PubChem CID | 10813578 |
| Molecular Formula | C12H4F6O8S2 |
| Molecular Weight | 454.28 g/mol |
| Exact Mass | 453.93 |
| IUPAC Name | [5,8-dioxo-4-(trifluoromethylsulfonyloxy)naphthalen-1-yl] trifluoromethanesulfonate |
| SMILES | O=C1C=CC(=O)c2c(OS(=O)(=O)C(F)(F)F)ccc(OS(=O)(=O)C(F)(F)F)c21 |
| InChI | InChI=1S/C12H4F6O8S2/c13-11(14,15)27(21,22)25-7-3-4-8(26-28(23,24)12(16,17)18)10-6(20)2-1-5(19)9(7)10/h1-4H |
| InChIKey | GJLMWMXGICLUQW-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 120.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 454.28 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [5,8-dioxo-4-(trifluoromethylsulfonyloxy)naphthalen-1-yl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5,8-dioxo-4-(trifluoromethylsulfonyloxy)naphthalen-1-yl] trifluoromethanesulfonate?
The IUPAC name of [5,8-dioxo-4-(trifluoromethylsulfonyloxy)naphthalen-1-yl] trifluoromethanesulfonate (CID 10813578) is [5,8-dioxo-4-(trifluoromethylsulfonyloxy)naphthalen-1-yl] trifluoromethanesulfonate.
What is the SMILES notation for [5,8-dioxo-4-(trifluoromethylsulfonyloxy)naphthalen-1-yl] trifluoromethanesulfonate?
The canonical SMILES for [5,8-dioxo-4-(trifluoromethylsulfonyloxy)naphthalen-1-yl] trifluoromethanesulfonate is O=C1C=CC(=O)c2c(OS(=O)(=O)C(F)(F)F)ccc(OS(=O)(=O)C(F)(F)F)c21.
What is the InChIKey of [5,8-dioxo-4-(trifluoromethylsulfonyloxy)naphthalen-1-yl] trifluoromethanesulfonate?
The InChIKey is GJLMWMXGICLUQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H4F6O8S2/c13-11(14,15)27(21,22)25-7-3-4-8(26-28(23,24)12(16,17)18)10-6(20)2-1-5(19)9(7)10/h1-4H.
What are the key properties of [5,8-dioxo-4-(trifluoromethylsulfonyloxy)naphthalen-1-yl] trifluoromethanesulfonate?
[5,8-dioxo-4-(trifluoromethylsulfonyloxy)naphthalen-1-yl] trifluoromethanesulfonate has a molecular weight of 454.28 g/mol, XLogP of 2.08, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [5,8-dioxo-4-(trifluoromethylsulfonyloxy)naphthalen-1-yl] trifluoromethanesulfonate is sourced from PubChem (CID 10813578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).