C30H36N2O2 — CID 10813700
benzyl N-[4-[1-(4-amino-3,5-dimethylphenyl)cyclohexyl]-2,6-dimethylphenyl]carbamate (PubChem CID 10813700) has the molecular formula C30H36N2O2 and a molecular weight of 456.63 g/mol. Its IUPAC name is benzyl N-[4-[1-(4-amino-3,5-dimethylphenyl)cyclohexyl]-2,6-dimethylphenyl]carbamate.
| Compound Name | benzyl N-[4-[1-(4-amino-3,5-dimethylphenyl)cyclohexyl]-2,6-dimethylphenyl]carbamate |
|---|---|
| PubChem CID | 10813700 |
| Molecular Formula | C30H36N2O2 |
| Molecular Weight | 456.63 g/mol |
| Exact Mass | 456.28 |
| IUPAC Name | benzyl N-[4-[1-(4-amino-3,5-dimethylphenyl)cyclohexyl]-2,6-dimethylphenyl]carbamate |
| SMILES | Cc1cc(C2(c3cc(C)c(NC(=O)OCc4ccccc4)c(C)c3)CCCCC2)cc(C)c1N |
| InChI | InChI=1S/C30H36N2O2/c1-20-15-25(16-21(2)27(20)31)30(13-9-6-10-14-30)26-17-22(3)28(23(4)18-26)32-29(33)34-19-24-11-7-5-8-12-24/h5,7-8,11-12,15-18H,6,9-10,13-14,19,31H2,1-4H3,(H,32,33) |
| InChIKey | MCZWBPDWHQDLCN-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.63 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|