C27H31NO6 — CID 10814024
(3S,4S,5S,6S)-4-(4-methoxyanilino)-3-phenylmethoxy-6-(phenylmethoxymethyl)oxane-2,5-diol (PubChem CID 10814024) has the molecular formula C27H31NO6 and a molecular weight of 465.55 g/mol. Its IUPAC name is (3S,4S,5S,6S)-4-(4-methoxyanilino)-3-phenylmethoxy-6-(phenylmethoxymethyl)oxane-2,5-diol.
| Compound Name | (3S,4S,5S,6S)-4-(4-methoxyanilino)-3-phenylmethoxy-6-(phenylmethoxymethyl)oxane-2,5-diol |
|---|---|
| PubChem CID | 10814024 |
| Molecular Formula | C27H31NO6 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.22 |
| IUPAC Name | (3S,4S,5S,6S)-4-(4-methoxyanilino)-3-phenylmethoxy-6-(phenylmethoxymethyl)oxane-2,5-diol |
| SMILES | COc1ccc(N[C@H]2[C@H](O)[C@H](COCc3ccccc3)OC(O)[C@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C27H31NO6/c1-31-22-14-12-21(13-15-22)28-24-25(29)23(18-32-16-19-8-4-2-5-9-19)34-27(30)26(24)33-17-20-10-6-3-7-11-20/h2-15,23-30H,16-18H2,1H3/t23-,24-,25+,26-,27?/m0/s1 |
| InChIKey | UYIKREBHDAPKKN-GRFCAYFBSA-N |
| XLogP | 3.36 |
| TPSA | 89.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|