C24H26N3O+ — CID 10814284
3-oxa-16,23-diaza-9-azoniaheptacyclo[17.7.1.15,9.02,17.04,15.023,27.013,28]octacosa-1(27),2(17),4,9(28),13,15,18-heptaene (PubChem CID 10814284) has the molecular formula C24H26N3O+ and a molecular weight of 372.49 g/mol. Its IUPAC name is 3-oxa-16,23-diaza-9-azoniaheptacyclo[17.7.1.15,9.02,17.04,15.023,27.013,28]octacosa-1(27),2(17),4,9(28),13,15,18-heptaene.
| Compound Name | 3-oxa-16,23-diaza-9-azoniaheptacyclo[17.7.1.15,9.02,17.04,15.023,27.013,28]octacosa-1(27),2(17),4,9(28),13,15,18-heptaene |
|---|---|
| PubChem CID | 10814284 |
| Molecular Formula | C24H26N3O+ |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | 3-oxa-16,23-diaza-9-azoniaheptacyclo[17.7.1.15,9.02,17.04,15.023,27.013,28]octacosa-1(27),2(17),4,9(28),13,15,18-heptaene |
| SMILES | c1c2c3c(c4c1N=c1cc5c6c(c1O4)CCC[N+]=6CCC5)CCCN3CCC2 |
| InChI | InChI=1S/C24H26N3O/c1-5-15-13-19-23(17-7-3-11-26(9-1)21(15)17)28-24-18-8-4-12-27-10-2-6-16(22(18)27)14-20(24)25-19/h13-14H,1-12H2/q+1 |
| InChIKey | PDIHZOTWTQBJGP-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 27.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|