C26H52O5Si — CID 10814327
[(E,3R,4S,5R,7R,8S)-5-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-3-methoxy-4,8-dimethyldodec-9-enyl] 2,2-dimethylpropanoate (PubChem CID 10814327) has the molecular formula C26H52O5Si and a molecular weight of 472.78 g/mol. Its IUPAC name is [(E,3R,4S,5R,7R,8S)-5-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-3-methoxy-4,8-dimethyldodec-9-enyl] 2,2-dimethylpropanoate.
| Compound Name | [(E,3R,4S,5R,7R,8S)-5-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-3-methoxy-4,8-dimethyldodec-9-enyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 10814327 |
| Molecular Formula | C26H52O5Si |
| Molecular Weight | 472.78 g/mol |
| Exact Mass | 472.36 |
| IUPAC Name | [(E,3R,4S,5R,7R,8S)-5-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-3-methoxy-4,8-dimethyldodec-9-enyl] 2,2-dimethylpropanoate |
| SMILES | CC/C=C/[C@H](C)[C@H](O)C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)[C@@H](CCOC(=O)C(C)(C)C)OC |
| InChI | InChI=1S/C26H52O5Si/c1-13-14-15-19(2)21(27)18-23(31-32(11,12)26(7,8)9)20(3)22(29-10)16-17-30-24(28)25(4,5)6/h14-15,19-23,27H,13,16-18H2,1-12H3/b15-14+/t19-,20-,21+,22+,23+/m0/s1 |
| InChIKey | ATZNGZMOZZNGMO-LJNAMVABSA-N |
| XLogP | 6.36 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.78 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|