About methyl 5-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-2,2-diphenylpentanoate
methyl 5-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-2,2-diphenylpentanoate (PubChem CID 10814504) has the molecular formula C29H32ClNO3
and a molecular weight of 478.03 g/mol. Its IUPAC name is methyl 5-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-2,2-diphenylpentanoate.
Molecular Properties
| Compound Name | methyl 5-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-2,2-diphenylpentanoate |
| PubChem CID | 10814504 |
| Molecular Formula | C29H32ClNO3 |
| Molecular Weight | 478.03 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | methyl 5-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-2,2-diphenylpentanoate |
| SMILES | COC(=O)C(CCCN1CCC(O)(c2ccc(Cl)cc2)CC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H32ClNO3/c1-34-27(32)29(24-9-4-2-5-10-24,25-11-6-3-7-12-25)17-8-20-31-21-18-28(33,19-22-31)23-13-15-26(30)16-14-23/h2-7,9-16,33H,8,17-22H2,1H3 |
| InChIKey | MVHSSBPHEADWGK-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 478.03 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 5-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-2,2-diphenylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-2,2-diphenylpentanoate?
The IUPAC name of methyl 5-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-2,2-diphenylpentanoate (CID 10814504) is methyl 5-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-2,2-diphenylpentanoate.
What is the SMILES notation for methyl 5-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-2,2-diphenylpentanoate?
The canonical SMILES for methyl 5-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-2,2-diphenylpentanoate is COC(=O)C(CCCN1CCC(O)(c2ccc(Cl)cc2)CC1)(c1ccccc1)c1ccccc1.
What is the InChIKey of methyl 5-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-2,2-diphenylpentanoate?
The InChIKey is MVHSSBPHEADWGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H32ClNO3/c1-34-27(32)29(24-9-4-2-5-10-24,25-11-6-3-7-12-25)17-8-20-31-21-18-28(33,19-22-31)23-13-15-26(30)16-14-23/h2-7,9-16,33H,8,17-22H2,1H3.
What are the key properties of methyl 5-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-2,2-diphenylpentanoate?
methyl 5-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-2,2-diphenylpentanoate has a molecular weight of 478.03 g/mol, XLogP of 5.56, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-2,2-diphenylpentanoate is sourced from PubChem (CID 10814504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).