C26H33FN6O2 — CID 10814587
4-[3-[4-(4-fluoro-2-methoxyphenyl)piperazin-1-yl]propylamino]-N,N,7-trimethyl-1,8-naphthyridine-3-carboxamide (PubChem CID 10814587) has the molecular formula C26H33FN6O2 and a molecular weight of 480.59 g/mol. Its IUPAC name is 4-[3-[4-(4-fluoro-2-methoxyphenyl)piperazin-1-yl]propylamino]-N,N,7-trimethyl-1,8-naphthyridine-3-carboxamide.
| Compound Name | 4-[3-[4-(4-fluoro-2-methoxyphenyl)piperazin-1-yl]propylamino]-N,N,7-trimethyl-1,8-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 10814587 |
| Molecular Formula | C26H33FN6O2 |
| Molecular Weight | 480.59 g/mol |
| Exact Mass | 480.26 |
| IUPAC Name | 4-[3-[4-(4-fluoro-2-methoxyphenyl)piperazin-1-yl]propylamino]-N,N,7-trimethyl-1,8-naphthyridine-3-carboxamide |
| SMILES | COc1cc(F)ccc1N1CCN(CCCNc2c(C(=O)N(C)C)cnc3nc(C)ccc23)CC1 |
| InChI | InChI=1S/C26H33FN6O2/c1-18-6-8-20-24(21(26(34)31(2)3)17-29-25(20)30-18)28-10-5-11-32-12-14-33(15-13-32)22-9-7-19(27)16-23(22)35-4/h6-9,16-17H,5,10-15H2,1-4H3,(H,28,29,30) |
| InChIKey | YBGJFTRZZKYHBW-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.59 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|