C12H6BrF5N2O4S2 — CID 10814610
N-(2-bromo-4-sulfamoylphenyl)-2,3,4,5,6-pentafluorobenzenesulfonamide (PubChem CID 10814610) has the molecular formula C12H6BrF5N2O4S2 and a molecular weight of 481.22 g/mol. Its IUPAC name is N-(2-bromo-4-sulfamoylphenyl)-2,3,4,5,6-pentafluorobenzenesulfonamide.
| Compound Name | N-(2-bromo-4-sulfamoylphenyl)-2,3,4,5,6-pentafluorobenzenesulfonamide |
|---|---|
| PubChem CID | 10814610 |
| Molecular Formula | C12H6BrF5N2O4S2 |
| Molecular Weight | 481.22 g/mol |
| Exact Mass | 479.89 |
| IUPAC Name | N-(2-bromo-4-sulfamoylphenyl)-2,3,4,5,6-pentafluorobenzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(NS(=O)(=O)c2c(F)c(F)c(F)c(F)c2F)c(Br)c1 |
| InChI | InChI=1S/C12H6BrF5N2O4S2/c13-5-3-4(25(19,21)22)1-2-6(5)20-26(23,24)12-10(17)8(15)7(14)9(16)11(12)18/h1-3,20H,(H2,19,21,22) |
| InChIKey | QMXBYMSYQDRJLN-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.22 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|