C27H13BrO4 — CID 10814614
2-[2-bromo-3-(1,3-dioxoinden-2-ylidene)inden-1-ylidene]indene-1,3-dione (PubChem CID 10814614) has the molecular formula C27H13BrO4 and a molecular weight of 481.30 g/mol. Its IUPAC name is 2-[2-bromo-3-(1,3-dioxoinden-2-ylidene)inden-1-ylidene]indene-1,3-dione.
| Compound Name | 2-[2-bromo-3-(1,3-dioxoinden-2-ylidene)inden-1-ylidene]indene-1,3-dione |
|---|---|
| PubChem CID | 10814614 |
| Molecular Formula | C27H13BrO4 |
| Molecular Weight | 481.30 g/mol |
| Exact Mass | 480.00 |
| IUPAC Name | 2-[2-bromo-3-(1,3-dioxoinden-2-ylidene)inden-1-ylidene]indene-1,3-dione |
| SMILES | O=C1C(=C2c3ccccc3C(=C3C(=O)c4ccccc4C3=O)C2Br)C(=O)c2ccccc21 |
| InChI | InChI=1S/C27H13BrO4/c28-23-19(21-24(29)15-9-3-4-10-16(15)25(21)30)13-7-1-2-8-14(13)20(23)22-26(31)17-11-5-6-12-18(17)27(22)32/h1-12,23H |
| InChIKey | YEEBGYBWKLMZCY-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.30 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|