C24H26N2O7S — CID 10814787
tert-butyl 2-[1-(benzenesulfonyl)-2-ethyl-3-oxamoylindol-4-yl]oxyacetate (PubChem CID 10814787) has the molecular formula C24H26N2O7S and a molecular weight of 486.55 g/mol. Its IUPAC name is tert-butyl 2-[1-(benzenesulfonyl)-2-ethyl-3-oxamoylindol-4-yl]oxyacetate.
| Compound Name | tert-butyl 2-[1-(benzenesulfonyl)-2-ethyl-3-oxamoylindol-4-yl]oxyacetate |
|---|---|
| PubChem CID | 10814787 |
| Molecular Formula | C24H26N2O7S |
| Molecular Weight | 486.55 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | tert-butyl 2-[1-(benzenesulfonyl)-2-ethyl-3-oxamoylindol-4-yl]oxyacetate |
| SMILES | CCc1c(C(=O)C(N)=O)c2c(OCC(=O)OC(C)(C)C)cccc2n1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C24H26N2O7S/c1-5-16-21(22(28)23(25)29)20-17(26(16)34(30,31)15-10-7-6-8-11-15)12-9-13-18(20)32-14-19(27)33-24(2,3)4/h6-13H,5,14H2,1-4H3,(H2,25,29) |
| InChIKey | LKJCJSRXALIRPV-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 134.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.55 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|