C26H32Cl2N4O — CID 10814818
1-[4-(7,13-dichloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaen-2-yl)piperazin-1-yl]-2-(1-methylpiperidin-4-yl)ethanone (PubChem CID 10814818) has the molecular formula C26H32Cl2N4O and a molecular weight of 487.48 g/mol. Its IUPAC name is 1-[4-(7,13-dichloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaen-2-yl)piperazin-1-yl]-2-(1-methylpiperidin-4-yl)ethanone.
| Compound Name | 1-[4-(7,13-dichloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaen-2-yl)piperazin-1-yl]-2-(1-methylpiperidin-4-yl)ethanone |
|---|---|
| PubChem CID | 10814818 |
| Molecular Formula | C26H32Cl2N4O |
| Molecular Weight | 487.48 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | 1-[4-(7,13-dichloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaen-2-yl)piperazin-1-yl]-2-(1-methylpiperidin-4-yl)ethanone |
| SMILES | CN1CCC(CC(=O)N2CCN(C3c4ccc(Cl)cc4CCc4c(Cl)ccnc43)CC2)CC1 |
| InChI | InChI=1S/C26H32Cl2N4O/c1-30-10-7-18(8-11-30)16-24(33)31-12-14-32(15-13-31)26-21-5-3-20(27)17-19(21)2-4-22-23(28)6-9-29-25(22)26/h3,5-6,9,17-18,26H,2,4,7-8,10-16H2,1H3 |
| InChIKey | KUDPIMFKJDNBBT-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.48 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |