C27H30N4O5 — CID 10814930
(1R,12S)-3-[(dimethylamino)methyl]-4-methyl-10-(5,6,7-trimethoxy-1H-indole-2-carbonyl)-5,10-diazatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-trien-7-one (PubChem CID 10814930) has the molecular formula C27H30N4O5 and a molecular weight of 490.56 g/mol. Its IUPAC name is (1R,12S)-3-[(dimethylamino)methyl]-4-methyl-10-(5,6,7-trimethoxy-1H-indole-2-carbonyl)-5,10-diazatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-trien-7-one.
| Compound Name | (1R,12S)-3-[(dimethylamino)methyl]-4-methyl-10-(5,6,7-trimethoxy-1H-indole-2-carbonyl)-5,10-diazatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-trien-7-one |
|---|---|
| PubChem CID | 10814930 |
| Molecular Formula | C27H30N4O5 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.22 |
| IUPAC Name | (1R,12S)-3-[(dimethylamino)methyl]-4-methyl-10-(5,6,7-trimethoxy-1H-indole-2-carbonyl)-5,10-diazatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-trien-7-one |
| SMILES | COc1cc2cc(C(=O)N3C[C@H]4C[C@@]45C3=CC(=O)c3[nH]c(C)c(CN(C)C)c35)[nH]c2c(OC)c1OC |
| InChI | InChI=1S/C27H30N4O5/c1-13-16(12-30(2)3)21-23(28-13)18(32)9-20-27(21)10-15(27)11-31(20)26(33)17-7-14-8-19(34-4)24(35-5)25(36-6)22(14)29-17/h7-9,15,28-29H,10-12H2,1-6H3/t15-,27+/m1/s1 |
| InChIKey | FXNMOIGDSCWVLF-RXAIFQJESA-N |
| XLogP | 3.39 |
| TPSA | 99.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |