C30H44O6 — CID 10815254
(2R,3S,4S)-2-(2-hydroxy-3,3,5,5-tetramethyl-4,6-dioxocyclohexen-1-yl)-6,6,8,8-tetramethyl-4-(2-methylpropyl)-3-propan-2-yl-3,4-dihydro-2H-chromene-5,7-dione (PubChem CID 10815254) has the molecular formula C30H44O6 and a molecular weight of 500.68 g/mol. Its IUPAC name is (2R,3S,4S)-2-(2-hydroxy-3,3,5,5-tetramethyl-4,6-dioxocyclohexen-1-yl)-6,6,8,8-tetramethyl-4-(2-methylpropyl)-3-propan-2-yl-3,4-dihydro-2H-chromene-5,7-dione.
| Compound Name | (2R,3S,4S)-2-(2-hydroxy-3,3,5,5-tetramethyl-4,6-dioxocyclohexen-1-yl)-6,6,8,8-tetramethyl-4-(2-methylpropyl)-3-propan-2-yl-3,4-dihydro-2H-chromene-5,7-dione |
|---|---|
| PubChem CID | 10815254 |
| Molecular Formula | C30H44O6 |
| Molecular Weight | 500.68 g/mol |
| Exact Mass | 500.31 |
| IUPAC Name | (2R,3S,4S)-2-(2-hydroxy-3,3,5,5-tetramethyl-4,6-dioxocyclohexen-1-yl)-6,6,8,8-tetramethyl-4-(2-methylpropyl)-3-propan-2-yl-3,4-dihydro-2H-chromene-5,7-dione |
| SMILES | CC(C)C[C@@H]1C2=C(O[C@@H](C3=C(O)C(C)(C)C(=O)C(C)(C)C3=O)[C@H]1C(C)C)C(C)(C)C(=O)C(C)(C)C2=O |
| InChI | InChI=1S/C30H44O6/c1-14(2)13-16-17(15(3)4)20(19-22(32)28(7,8)25(34)29(9,10)23(19)33)36-24-18(16)21(31)27(5,6)26(35)30(24,11)12/h14-17,20,32H,13H2,1-12H3/t16-,17-,20+/m0/s1 |
| InChIKey | VXGYLHHZNVRJQJ-ABSDTBQOSA-N |
| XLogP | 5.79 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.68 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|