C27H45CuN2O3 — CID 10815488
carboxymethyl-[(2S)-2-(dioctylamino)-3-phenylpropanoyl]azanide;copper(1+) (PubChem CID 10815488) has the molecular formula C27H45CuN2O3 and a molecular weight of 509.21 g/mol. Its IUPAC name is carboxymethyl-[(2S)-2-(dioctylamino)-3-phenylpropanoyl]azanide;copper(1+).
| Compound Name | carboxymethyl-[(2S)-2-(dioctylamino)-3-phenylpropanoyl]azanide;copper(1+) |
|---|---|
| PubChem CID | 10815488 |
| Molecular Formula | C27H45CuN2O3 |
| Molecular Weight | 509.21 g/mol |
| Exact Mass | 508.27 |
| IUPAC Name | carboxymethyl-[(2S)-2-(dioctylamino)-3-phenylpropanoyl]azanide;copper(1+) |
| SMILES | CCCCCCCCN(CCCCCCCC)[C@@H](Cc1ccccc1)C(=O)[N-]CC(=O)O.[Cu+] |
| InChI | InChI=1S/C27H46N2O3.Cu/c1-3-5-7-9-11-16-20-29(21-17-12-10-8-6-4-2)25(27(32)28-23-26(30)31)22-24-18-14-13-15-19-24;/h13-15,18-19,25H,3-12,16-17,20-23H2,1-2H3,(H2,28,30,31,32);/q;+1/p-1/t25-;/m0./s1 |
| InChIKey | AHQUVCOSFVRSKL-UQIIZPHYSA-M |
| XLogP | 6.60 |
| TPSA | 71.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.21 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|