C26H36O10 — CID 10815501
[(2R,4R,4aR,5R,6R,7S,8R,8aR)-5,6-diacetyloxy-4a-formyl-7,8-dimethyl-8-[2-[(3S)-2-oxooxolan-3-yl]ethyl]spiro[2,3,5,6,7,8a-hexahydro-1H-naphthalene-4,2'-oxirane]-2-yl] acetate (PubChem CID 10815501) has the molecular formula C26H36O10 and a molecular weight of 508.56 g/mol. Its IUPAC name is [(2R,4R,4aR,5R,6R,7S,8R,8aR)-5,6-diacetyloxy-4a-formyl-7,8-dimethyl-8-[2-[(3S)-2-oxooxolan-3-yl]ethyl]spiro[2,3,5,6,7,8a-hexahydro-1H-naphthalene-4,2'-oxirane]-2-yl] acetate.
| Compound Name | [(2R,4R,4aR,5R,6R,7S,8R,8aR)-5,6-diacetyloxy-4a-formyl-7,8-dimethyl-8-[2-[(3S)-2-oxooxolan-3-yl]ethyl]spiro[2,3,5,6,7,8a-hexahydro-1H-naphthalene-4,2'-oxirane]-2-yl] acetate |
|---|---|
| PubChem CID | 10815501 |
| Molecular Formula | C26H36O10 |
| Molecular Weight | 508.56 g/mol |
| Exact Mass | 508.23 |
| IUPAC Name | [(2R,4R,4aR,5R,6R,7S,8R,8aR)-5,6-diacetyloxy-4a-formyl-7,8-dimethyl-8-[2-[(3S)-2-oxooxolan-3-yl]ethyl]spiro[2,3,5,6,7,8a-hexahydro-1H-naphthalene-4,2'-oxirane]-2-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@@H]2[C@@](C)(CC[C@H]3CCOC3=O)[C@H](C)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@]2(C=O)[C@@]2(CO2)C1 |
| InChI | InChI=1S/C26H36O10/c1-14-21(35-16(3)29)22(36-17(4)30)26(12-27)20(10-19(34-15(2)28)11-25(26)13-33-25)24(14,5)8-6-18-7-9-32-23(18)31/h12,14,18-22H,6-11,13H2,1-5H3/t14-,18+,19-,20-,21-,22+,24+,25+,26+/m1/s1 |
| InChIKey | YKQQJTNCEQZDQM-GBUFXDRDSA-N |
| XLogP | 2.15 |
| TPSA | 134.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.56 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|