C25H31N7O3S — CID 10815546
1-[3-(1H-imidazol-2-ylamino)propyl]-N-[2-[(2,4,6-trimethylphenyl)sulfonylamino]ethyl]indazole-5-carboxamide (PubChem CID 10815546) has the molecular formula C25H31N7O3S and a molecular weight of 509.64 g/mol. Its IUPAC name is 1-[3-(1H-imidazol-2-ylamino)propyl]-N-[2-[(2,4,6-trimethylphenyl)sulfonylamino]ethyl]indazole-5-carboxamide.
| Compound Name | 1-[3-(1H-imidazol-2-ylamino)propyl]-N-[2-[(2,4,6-trimethylphenyl)sulfonylamino]ethyl]indazole-5-carboxamide |
|---|---|
| PubChem CID | 10815546 |
| Molecular Formula | C25H31N7O3S |
| Molecular Weight | 509.64 g/mol |
| Exact Mass | 509.22 |
| IUPAC Name | 1-[3-(1H-imidazol-2-ylamino)propyl]-N-[2-[(2,4,6-trimethylphenyl)sulfonylamino]ethyl]indazole-5-carboxamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)NCCNC(=O)c2ccc3c(cnn3CCCNc3ncc[nH]3)c2)c(C)c1 |
| InChI | InChI=1S/C25H31N7O3S/c1-17-13-18(2)23(19(3)14-17)36(34,35)31-11-10-26-24(33)20-5-6-22-21(15-20)16-30-32(22)12-4-7-27-25-28-8-9-29-25/h5-6,8-9,13-16,31H,4,7,10-12H2,1-3H3,(H,26,33)(H2,27,28,29) |
| InChIKey | KZWXURXERGGSGN-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 133.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.64 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|