About (4-sulfamoylphenyl)methyl 2-(2,6-dimethyl-4-phenylpyridin-1-ium-1-yl)acetate perchlorate
(4-sulfamoylphenyl)methyl 2-(2,6-dimethyl-4-phenylpyridin-1-ium-1-yl)acetate perchlorate (PubChem CID 10815580) has the molecular formula C22H23ClN2O8S
and a molecular weight of 510.95 g/mol. Its IUPAC name is (4-sulfamoylphenyl)methyl 2-(2,6-dimethyl-4-phenylpyridin-1-ium-1-yl)acetate perchlorate.
Molecular Properties
| Compound Name | (4-sulfamoylphenyl)methyl 2-(2,6-dimethyl-4-phenylpyridin-1-ium-1-yl)acetate perchlorate |
| PubChem CID | 10815580 |
| Molecular Formula | C22H23ClN2O8S |
| Molecular Weight | 510.95 g/mol |
| Exact Mass | 510.09 |
| IUPAC Name | (4-sulfamoylphenyl)methyl 2-(2,6-dimethyl-4-phenylpyridin-1-ium-1-yl)acetate perchlorate |
| SMILES | Cc1cc(-c2ccccc2)cc(C)[n+]1CC(=O)OCc1ccc(S(N)(=O)=O)cc1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C22H23N2O4S.ClHO4/c1-16-12-20(19-6-4-3-5-7-19)13-17(2)24(16)14-22(25)28-15-18-8-10-21(11-9-18)29(23,26)27;2-1(3,4)5/h3-13H,14-15H2,1-2H3,(H2,23,26,27);(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | IYDOTYRIXUGQIJ-UHFFFAOYSA-M |
| XLogP | -2.11 |
| TPSA | 182.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 510.95 |
| LogP ≤ 5 | -2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze (4-sulfamoylphenyl)methyl 2-(2,6-dimethyl-4-phenylpyridin-1-ium-1-yl)acetate perchlorate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-sulfamoylphenyl)methyl 2-(2,6-dimethyl-4-phenylpyridin-1-ium-1-yl)acetate perchlorate?
The IUPAC name of (4-sulfamoylphenyl)methyl 2-(2,6-dimethyl-4-phenylpyridin-1-ium-1-yl)acetate perchlorate (CID 10815580) is (4-sulfamoylphenyl)methyl 2-(2,6-dimethyl-4-phenylpyridin-1-ium-1-yl)acetate perchlorate.
What is the SMILES notation for (4-sulfamoylphenyl)methyl 2-(2,6-dimethyl-4-phenylpyridin-1-ium-1-yl)acetate perchlorate?
The canonical SMILES for (4-sulfamoylphenyl)methyl 2-(2,6-dimethyl-4-phenylpyridin-1-ium-1-yl)acetate perchlorate is Cc1cc(-c2ccccc2)cc(C)[n+]1CC(=O)OCc1ccc(S(N)(=O)=O)cc1.[O-][Cl+3]([O-])([O-])[O-].
What is the InChIKey of (4-sulfamoylphenyl)methyl 2-(2,6-dimethyl-4-phenylpyridin-1-ium-1-yl)acetate perchlorate?
The InChIKey is IYDOTYRIXUGQIJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C22H23N2O4S.ClHO4/c1-16-12-20(19-6-4-3-5-7-19)13-17(2)24(16)14-22(25)28-15-18-8-10-21(11-9-18)29(23,26)27;2-1(3,4)5/h3-13H,14-15H2,1-2H3,(H2,23,26,27);(H,2,3,4,5)/q+1;/p-1.
What are the key properties of (4-sulfamoylphenyl)methyl 2-(2,6-dimethyl-4-phenylpyridin-1-ium-1-yl)acetate perchlorate?
(4-sulfamoylphenyl)methyl 2-(2,6-dimethyl-4-phenylpyridin-1-ium-1-yl)acetate perchlorate has a molecular weight of 510.95 g/mol, XLogP of -2.11, 6 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (4-sulfamoylphenyl)methyl 2-(2,6-dimethyl-4-phenylpyridin-1-ium-1-yl)acetate perchlorate is sourced from PubChem (CID 10815580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).