C27H32F3N5O2 — CID 10815708
N,N-dimethyl-4-[3-[4-[2-(2,2,2-trifluoroethoxy)phenyl]piperazin-1-yl]propylamino]quinoline-3-carboxamide (PubChem CID 10815708) has the molecular formula C27H32F3N5O2 and a molecular weight of 515.58 g/mol. Its IUPAC name is N,N-dimethyl-4-[3-[4-[2-(2,2,2-trifluoroethoxy)phenyl]piperazin-1-yl]propylamino]quinoline-3-carboxamide.
| Compound Name | N,N-dimethyl-4-[3-[4-[2-(2,2,2-trifluoroethoxy)phenyl]piperazin-1-yl]propylamino]quinoline-3-carboxamide |
|---|---|
| PubChem CID | 10815708 |
| Molecular Formula | C27H32F3N5O2 |
| Molecular Weight | 515.58 g/mol |
| Exact Mass | 515.25 |
| IUPAC Name | N,N-dimethyl-4-[3-[4-[2-(2,2,2-trifluoroethoxy)phenyl]piperazin-1-yl]propylamino]quinoline-3-carboxamide |
| SMILES | CN(C)C(=O)c1cnc2ccccc2c1NCCCN1CCN(c2ccccc2OCC(F)(F)F)CC1 |
| InChI | InChI=1S/C27H32F3N5O2/c1-33(2)26(36)21-18-32-22-9-4-3-8-20(22)25(21)31-12-7-13-34-14-16-35(17-15-34)23-10-5-6-11-24(23)37-19-27(28,29)30/h3-6,8-11,18H,7,12-17,19H2,1-2H3,(H,31,32) |
| InChIKey | ASVLTVMZMRWUDI-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.58 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|