C19H38INO4Si2 — CID 10815976
(3R,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-1-(3-iodopropyl)pyrrolidine-2,5-dione (PubChem CID 10815976) has the molecular formula C19H38INO4Si2 and a molecular weight of 527.59 g/mol. Its IUPAC name is (3R,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-1-(3-iodopropyl)pyrrolidine-2,5-dione.
| Compound Name | (3R,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-1-(3-iodopropyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 10815976 |
| Molecular Formula | C19H38INO4Si2 |
| Molecular Weight | 527.59 g/mol |
| Exact Mass | 527.14 |
| IUPAC Name | (3R,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-1-(3-iodopropyl)pyrrolidine-2,5-dione |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1C(=O)N(CCCI)C(=O)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H38INO4Si2/c1-18(2,3)26(7,8)24-14-15(25-27(9,10)19(4,5)6)17(23)21(16(14)22)13-11-12-20/h14-15H,11-13H2,1-10H3/t14-,15-/m1/s1 |
| InChIKey | OPNOFFYKMMUKOO-HUUCEWRRSA-N |
| XLogP | 4.96 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.59 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|