C25H27F3N4O6 — CID 10816188
2-[3-(2-ethoxyethyl)-2,4,8-trioxo-6-phenyl-1H-pyrido[3,4-d]pyrimidin-7-yl]-N-(1,1,1-trifluoro-4-methyl-2-oxopentan-3-yl)acetamide (PubChem CID 10816188) has the molecular formula C25H27F3N4O6 and a molecular weight of 536.51 g/mol. Its IUPAC name is 2-[3-(2-ethoxyethyl)-2,4,8-trioxo-6-phenyl-1H-pyrido[3,4-d]pyrimidin-7-yl]-N-(1,1,1-trifluoro-4-methyl-2-oxopentan-3-yl)acetamide.
| Compound Name | 2-[3-(2-ethoxyethyl)-2,4,8-trioxo-6-phenyl-1H-pyrido[3,4-d]pyrimidin-7-yl]-N-(1,1,1-trifluoro-4-methyl-2-oxopentan-3-yl)acetamide |
|---|---|
| PubChem CID | 10816188 |
| Molecular Formula | C25H27F3N4O6 |
| Molecular Weight | 536.51 g/mol |
| Exact Mass | 536.19 |
| IUPAC Name | 2-[3-(2-ethoxyethyl)-2,4,8-trioxo-6-phenyl-1H-pyrido[3,4-d]pyrimidin-7-yl]-N-(1,1,1-trifluoro-4-methyl-2-oxopentan-3-yl)acetamide |
| SMILES | CCOCCn1c(=O)[nH]c2c(=O)n(CC(=O)NC(C(=O)C(F)(F)F)C(C)C)c(-c3ccccc3)cc2c1=O |
| InChI | InChI=1S/C25H27F3N4O6/c1-4-38-11-10-31-22(35)16-12-17(15-8-6-5-7-9-15)32(23(36)20(16)30-24(31)37)13-18(33)29-19(14(2)3)21(34)25(26,27)28/h5-9,12,14,19H,4,10-11,13H2,1-3H3,(H,29,33)(H,30,37) |
| InChIKey | LTKADXBHDBCMBY-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 132.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.51 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|