C28H21F6N3O2 — CID 10816374
7-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(4-methylphenyl)-9,10-dihydro-8H-[1,4]diazepino[2,1-g][1,7]naphthyridine-6,12-dione (PubChem CID 10816374) has the molecular formula C28H21F6N3O2 and a molecular weight of 545.48 g/mol. Its IUPAC name is 7-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(4-methylphenyl)-9,10-dihydro-8H-[1,4]diazepino[2,1-g][1,7]naphthyridine-6,12-dione.
| Compound Name | 7-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(4-methylphenyl)-9,10-dihydro-8H-[1,4]diazepino[2,1-g][1,7]naphthyridine-6,12-dione |
|---|---|
| PubChem CID | 10816374 |
| Molecular Formula | C28H21F6N3O2 |
| Molecular Weight | 545.48 g/mol |
| Exact Mass | 545.15 |
| IUPAC Name | 7-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(4-methylphenyl)-9,10-dihydro-8H-[1,4]diazepino[2,1-g][1,7]naphthyridine-6,12-dione |
| SMILES | Cc1ccc(-c2c3n(c(=O)c4ncccc24)CCCN(Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)C3=O)cc1 |
| InChI | InChI=1S/C28H21F6N3O2/c1-16-5-7-18(8-6-16)22-21-4-2-9-35-23(21)25(38)37-11-3-10-36(26(39)24(22)37)15-17-12-19(27(29,30)31)14-20(13-17)28(32,33)34/h2,4-9,12-14H,3,10-11,15H2,1H3 |
| InChIKey | JWRJCBGNBMANEE-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.48 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |