C26H42O12 — CID 10816393
methyl (1R,2R,3S,4S,5S,6S,9S,10R,11R,12S,13S,16R)-2,3,6-trihydroxy-11,12-bis(methoxymethoxy)-16-(2-methoxy-2-oxoethyl)-5,9-dimethyl-14-oxatetracyclo[11.2.1.01,10.04,9]hexadecane-13-carboxylate (PubChem CID 10816393) has the molecular formula C26H42O12 and a molecular weight of 546.61 g/mol. Its IUPAC name is methyl (1R,2R,3S,4S,5S,6S,9S,10R,11R,12S,13S,16R)-2,3,6-trihydroxy-11,12-bis(methoxymethoxy)-16-(2-methoxy-2-oxoethyl)-5,9-dimethyl-14-oxatetracyclo[11.2.1.01,10.04,9]hexadecane-13-carboxylate.
| Compound Name | methyl (1R,2R,3S,4S,5S,6S,9S,10R,11R,12S,13S,16R)-2,3,6-trihydroxy-11,12-bis(methoxymethoxy)-16-(2-methoxy-2-oxoethyl)-5,9-dimethyl-14-oxatetracyclo[11.2.1.01,10.04,9]hexadecane-13-carboxylate |
|---|---|
| PubChem CID | 10816393 |
| Molecular Formula | C26H42O12 |
| Molecular Weight | 546.61 g/mol |
| Exact Mass | 546.27 |
| IUPAC Name | methyl (1R,2R,3S,4S,5S,6S,9S,10R,11R,12S,13S,16R)-2,3,6-trihydroxy-11,12-bis(methoxymethoxy)-16-(2-methoxy-2-oxoethyl)-5,9-dimethyl-14-oxatetracyclo[11.2.1.01,10.04,9]hexadecane-13-carboxylate |
| SMILES | COCO[C@@H]1[C@@H]2[C@@]3(C)CC[C@H](O)[C@@H](C)[C@@H]3[C@H](O)[C@H](O)[C@]23CO[C@](C(=O)OC)([C@H]1OCOC)[C@@H]3CC(=O)OC |
| InChI | InChI=1S/C26H42O12/c1-13-14(27)7-8-24(2)17(13)18(29)21(30)25-10-38-26(23(31)35-6,15(25)9-16(28)34-5)22(37-12-33-4)19(20(24)25)36-11-32-3/h13-15,17-22,27,29-30H,7-12H2,1-6H3/t13-,14+,15-,17-,18+,19-,20-,21+,22+,24+,25+,26+/m1/s1 |
| InChIKey | GMQMAOHJNDTMAM-ATMKZDGWSA-N |
| XLogP | -0.15 |
| TPSA | 159.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.61 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|