C11H3Cl2F15N4 — CID 10816414
4,6-dichloro-N-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctyl)-1,3,5-triazin-2-amine (PubChem CID 10816414) has the molecular formula C11H3Cl2F15N4 and a molecular weight of 547.05 g/mol. Its IUPAC name is 4,6-dichloro-N-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctyl)-1,3,5-triazin-2-amine.
| Compound Name | 4,6-dichloro-N-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 10816414 |
| Molecular Formula | C11H3Cl2F15N4 |
| Molecular Weight | 547.05 g/mol |
| Exact Mass | 545.95 |
| IUPAC Name | 4,6-dichloro-N-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctyl)-1,3,5-triazin-2-amine |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CNc1nc(Cl)nc(Cl)n1 |
| InChI | InChI=1S/C11H3Cl2F15N4/c12-2-30-3(13)32-4(31-2)29-1-5(14,15)6(16,17)7(18,19)8(20,21)9(22,23)10(24,25)11(26,27)28/h1H2,(H,29,30,31,32) |
| InChIKey | IABJPBBALGOPJY-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.05 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|